359-37-5 iodotrifluoroethylene
| ürün Ad? |
iodotrifluoroethylene |
| ingilizce ad? |
iodotrifluoroethylene; Trifluoroiodoethylene; 1,1,2-trifluoro-2-iodoethene |
| Moleküler Formülü |
C2F3I |
| Molekül A??rl??? |
207.9211 |
| InChI |
InChI=1/C2F3I/c3-1(4)2(5)6 |
| CAS kay?t numaras? |
359-37-5 |
| EINECS |
206-629-9 |
| Moleküler Yap?s? |
|
| Yo?unluk |
2.311g/cm3 |
| Kaynama noktas? |
30°C at 760 mmHg |
| K?r?lma indisi |
1.457 |
| Buhar bas?nc? |
636mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|