359-37-5 iodotrifluoroethylene
| ??? ????? |
iodotrifluoroethylene |
| ??? ??????? |
iodotrifluoroethylene; Trifluoroiodoethylene; 1,1,2-trifluoro-2-iodoethene |
| ????? ???????? |
C2F3I |
| ??? ??????? |
207.9211 |
| InChI |
InChI=1/C2F3I/c3-1(4)2(5)6 |
| ????? ?????? |
359-37-5 |
| ????? ??????? ??????? |
206-629-9 |
| ?????? ??????? |
|
| ????? |
2.311g/cm3 |
| ???? ????? |
30°C at 760 mmHg |
| ???? ???? |
1.457 |
| ???? ???? |
636mmHg at 25°C |
| ????? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|