359-37-5 iodotrifluoroethylene
| název vyrobku |
iodotrifluoroethylene |
| Anglicky název |
iodotrifluoroethylene; Trifluoroiodoethylene; 1,1,2-trifluoro-2-iodoethene |
| Molekulární vzorec |
C2F3I |
| Molekulová hmotnost |
207.9211 |
| InChI |
InChI=1/C2F3I/c3-1(4)2(5)6 |
| Registra?ní ?íslo CAS |
359-37-5 |
| EINECS |
206-629-9 |
| Molekulární struktura |
|
| Hustota |
2.311g/cm3 |
| Bod varu |
30°C at 760 mmHg |
| Index lomu |
1.457 |
| Tlak par |
636mmHg at 25°C |
| Riziko Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpe?nostní Popis |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|