359-37-5 iodotrifluoroethylene
| Produkt-Name |
iodotrifluoroethylene |
| Englischer Name |
iodotrifluoroethylene; Trifluoroiodoethylene; 1,1,2-trifluoro-2-iodoethene |
| Molekulare Formel |
C2F3I |
| Molecular Weight |
207.9211 |
| InChI |
InChI=1/C2F3I/c3-1(4)2(5)6 |
| CAS Registry Number |
359-37-5 |
| EINECS |
206-629-9 |
| Molecular Structure |
|
| Dichte |
2.311g/cm3 |
| Siedepunkt |
30°C at 760 mmHg |
| Brechungsindex |
1.457 |
| Dampfdruck |
636mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|