359-37-5 iodotrifluoroethylene
| produktnavn |
iodotrifluoroethylene |
| Engelsk navn |
iodotrifluoroethylene; Trifluoroiodoethylene; 1,1,2-trifluoro-2-iodoethene |
| Molekyl?r Formel |
C2F3I |
| Molekylvekt |
207.9211 |
| InChI |
InChI=1/C2F3I/c3-1(4)2(5)6 |
| CAS-nummer |
359-37-5 |
| EINECS |
206-629-9 |
| Molecular Structure |
|
| Tetthet |
2.311g/cm3 |
| Kokepunkt |
30°C at 760 mmHg |
| Brytningsindeks |
1.457 |
| Damptrykk |
636mmHg at 25°C |
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|