359-37-5 iodotrifluoroethylene
| Naam product |
iodotrifluoroethylene |
| Engelse naam |
iodotrifluoroethylene; Trifluoroiodoethylene; 1,1,2-trifluoro-2-iodoethene |
| MF |
C2F3I |
| Molecuulgewicht |
207.9211 |
| InChI |
InChI=1/C2F3I/c3-1(4)2(5)6 |
| CAS-nummer |
359-37-5 |
| EINECS |
206-629-9 |
| Moleculaire Structuur |
|
| Dichtheid |
2.311g/cm3 |
| Kookpunt |
30°C at 760 mmHg |
| Brekingsindex |
1.457 |
| Dampdruk |
636mmHg at 25°C |
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|