359-37-5 iodotrifluoroethylene
| Ονομασ?α του προ??ντο? |
iodotrifluoroethylene |
| Αγγλικ? ?νομα |
iodotrifluoroethylene; Trifluoroiodoethylene; 1,1,2-trifluoro-2-iodoethene |
| MF |
C2F3I |
| Μοριακ? β?ρο? |
207.9211 |
| InChI |
InChI=1/C2F3I/c3-1(4)2(5)6 |
| CAS ΟΧΙ |
359-37-5 |
| EINECS |
206-629-9 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
2.311g/cm3 |
| Σημε?ο βρασμο? |
30°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.457 |
| Π?εση ατμ?ν |
636mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|