ChemNet > CAS > 130723-54-5 3-Iodophenylacetonitrile
130723-54-5 3-Iodophenylacetonitrile
| ürün Ad? |
3-Iodophenylacetonitrile |
| ingilizce ad? |
3-Iodophenylacetonitrile; 3-Iodobenzyl cyanide |
| Moleküler Formülü |
C8H6IN |
| Molekül A??rl??? |
243.0444 |
| InChI |
InChI=1/C8H6IN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4H2 |
| CAS kay?t numaras? |
130723-54-5 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.764g/cm3 |
| Kaynama noktas? |
308.6°C at 760 mmHg |
| K?r?lma indisi |
1.624 |
| Alevlenme noktas? |
140.4°C |
| Buhar bas?nc? |
0.000674mmHg at 25°C |
| Risk Kodlar? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik A??klamas? |
S36/37:Wear suitable protective clothing and gloves.;
|
|