ChemNet > CAS > 130723-54-5 3-Iodophenylacetonitrile
130723-54-5 3-Iodophenylacetonitrile
| Nama produk |
3-Iodophenylacetonitrile |
| Nama Inggeris |
3-Iodophenylacetonitrile; 3-Iodobenzyl cyanide |
| MF |
C8H6IN |
| Berat Molekul |
243.0444 |
| InChI |
InChI=1/C8H6IN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4H2 |
| CAS NO |
130723-54-5 |
| Struktur Molekul |
|
| Kepadatan |
1.764g/cm3 |
| Titik didih |
308.6°C at 760 mmHg |
| Indeks bias |
1.624 |
| Titik nyala |
140.4°C |
| Tekanan wap |
0.000674mmHg at 25°C |
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Penerangan |
S36/37:Wear suitable protective clothing and gloves.;
|
|