ChemNet > CAS > 130723-54-5 3-Iodophenylacetonitrile
130723-54-5 3-Iodophenylacetonitrile
| termék neve |
3-Iodophenylacetonitrile |
| Angol név |
3-Iodophenylacetonitrile; 3-Iodobenzyl cyanide |
| MF |
C8H6IN |
| Molekulat?meg |
243.0444 |
| InChI |
InChI=1/C8H6IN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4H2 |
| CAS-szám |
130723-54-5 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.764g/cm3 |
| Forráspont |
308.6°C at 760 mmHg |
| T?résmutató |
1.624 |
| Gyulladáspont |
140.4°C |
| G?znyomás |
0.000674mmHg at 25°C |
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|