ChemNet > CAS > 130723-54-5 3-Iodophenylacetonitrile
130723-54-5 3-Iodophenylacetonitrile
| produktnavn |
3-Iodophenylacetonitrile |
| Engelsk navn |
3-Iodophenylacetonitrile; 3-Iodobenzyl cyanide |
| Molekyl?r Formel |
C8H6IN |
| Molekylvekt |
243.0444 |
| InChI |
InChI=1/C8H6IN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4H2 |
| CAS-nummer |
130723-54-5 |
| Molecular Structure |
|
| Tetthet |
1.764g/cm3 |
| Kokepunkt |
308.6°C at 760 mmHg |
| Brytningsindeks |
1.624 |
| Flammepunktet |
140.4°C |
| Damptrykk |
0.000674mmHg at 25°C |
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|