ChemNet > CAS > 130723-54-5 3-Iodophenylacetonitrile
130723-54-5 3-Iodophenylacetonitrile
| Nome del prodotto |
3-Iodophenylacetonitrile |
| Nome inglese |
3-Iodophenylacetonitrile; 3-Iodobenzyl cyanide |
| Formula molecolare |
C8H6IN |
| Peso Molecolare |
243.0444 |
| InChI |
InChI=1/C8H6IN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4H2 |
| Numero CAS |
130723-54-5 |
| Struttura molecolare |
|
| Densità |
1.764g/cm3 |
| Punto di ebollizione |
308.6°C at 760 mmHg |
| Indice di rifrazione |
1.624 |
| Punto d'infiammabilità |
140.4°C |
| Pressione di vapore |
0.000674mmHg at 25°C |
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S36/37:Wear suitable protective clothing and gloves.;
|
|