ChemNet > CAS > 130723-54-5 3-Iodophenylacetonitrile
130723-54-5 3-Iodophenylacetonitrile
| product Name |
3-Iodophenylacetonitrile |
| CAS No |
130723-54-5 |
| Synonyms |
3-Iodobenzyl cyanide |
| Molecular Formula |
C8H6IN |
| Molecular Weight |
243.0444 |
| InChI |
InChI=1/C8H6IN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4H2 |
| Molecular Structure |
|
| Density |
1.764g/cm3 |
| Boiling point |
308.6°C at 760 mmHg |
| Refractive index |
1.624 |
| Flash point |
140.4°C |
| Vapour Pressur |
0.000674mmHg at 25°C |
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
|
Featured China Suppliers
| Contact |
Mr Chen Wei-dong |
| Telephone |
+86-21-64251386 |
| Email |
wdchen@shwychem.com |
| Address |
HQ in Shanghai: 4st Floor S&T Industry Building, 130 Meilong Road, Shanghai200237,China |
| Telephone |
+86-21-54450828,+86-13501997194 |
| Email |
coco.yang@fwdchem.com |
| Address |
Room 802,Lotus Tower ,159 Tianzhou Road, Xuhui District,Shanghai 200233 ,P.R.China |