ChemNet > CAS > 130723-54-5 3-Iodophenylacetonitrile
130723-54-5 3-Iodophenylacetonitrile
| Nome do produto |
3-Iodophenylacetonitrile |
| Nome em inglês |
3-Iodophenylacetonitrile; 3-Iodobenzyl cyanide |
| Fórmula molecular |
C8H6IN |
| Peso Molecular |
243.0444 |
| InChI |
InChI=1/C8H6IN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4H2 |
| CAS Registry Number |
130723-54-5 |
| Estrutura Molecular |
|
| Densidade |
1.764g/cm3 |
| Ponto de ebuli??o |
308.6°C at 760 mmHg |
| índice de refra??o |
1.624 |
| O ponto de inflama??o |
140.4°C |
| Press?o de vapor |
0.000674mmHg at 25°C |
| Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Descri??o da Seguran?a |
S36/37:Wear suitable protective clothing and gloves.;
|
|