ChemNet > CAS > 1638-86-4 Diethyl phenylphosphonite
1638-86-4 Diethyl phenylphosphonite
| ürün Ad? |
Diethyl phenylphosphonite |
| ingilizce ad? |
Diethyl phenylphosphonite; Diethoxyphenylphosphine; Phenylphosphonous acid diethyl ester |
| Moleküler Formülü |
C10H15O2P |
| Molekül A??rl??? |
198.1987 |
| InChI |
InChI=1/C10H15O2P/c1-3-11-13(12-4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| CAS kay?t numaras? |
1638-86-4 |
| EINECS |
216-676-7 |
| Moleküler Yap?s? |
|
| Kaynama noktas? |
235°C at 760 mmHg |
| Alevlenme noktas? |
113°C |
| Buhar bas?nc? |
0.0784mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|