ChemNet > CAS > 1638-86-4 Diethyl phenylphosphonite
1638-86-4 Diethyl phenylphosphonite
| Naam product |
Diethyl phenylphosphonite |
| Engelse naam |
Diethyl phenylphosphonite; Diethoxyphenylphosphine; Phenylphosphonous acid diethyl ester |
| MF |
C10H15O2P |
| Molecuulgewicht |
198.1987 |
| InChI |
InChI=1/C10H15O2P/c1-3-11-13(12-4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| CAS-nummer |
1638-86-4 |
| EINECS |
216-676-7 |
| Moleculaire Structuur |
|
| Kookpunt |
235°C at 760 mmHg |
| Vlampunt |
113°C |
| Dampdruk |
0.0784mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|