ChemNet > CAS > 1638-86-4 Diethyl phenylphosphonite
1638-86-4 Diethyl phenylphosphonite
| Название продукта |
Diethyl phenylphosphonite |
| Английское название |
Diethyl phenylphosphonite; Diethoxyphenylphosphine; Phenylphosphonous acid diethyl ester |
| Молекулярная формула |
C10H15O2P |
| Молекулярный вес |
198.1987 |
| InChI |
InChI=1/C10H15O2P/c1-3-11-13(12-4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| Регистрационный номер CAS |
1638-86-4 |
| EINECS |
216-676-7 |
| Молекулярная структура |
|
| Точка кипения |
235°C at 760 mmHg |
| Температура вспышки |
113°C |
| Давление пара |
0.0784mmHg at 25°C |
| Характеристики безопасности |
S24/25:Avoid contact with skin and eyes.;
|
|