ChemNet > CAS > 1638-86-4 Diethyl phenylphosphonite
1638-86-4 Diethyl phenylphosphonite
| Produkt-Name |
Diethyl phenylphosphonite |
| Englischer Name |
Diethyl phenylphosphonite; Diethoxyphenylphosphine; Phenylphosphonous acid diethyl ester |
| Molekulare Formel |
C10H15O2P |
| Molecular Weight |
198.1987 |
| InChI |
InChI=1/C10H15O2P/c1-3-11-13(12-4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| CAS Registry Number |
1638-86-4 |
| EINECS |
216-676-7 |
| Molecular Structure |
|
| Siedepunkt |
235°C at 760 mmHg |
| Flammpunkt |
113°C |
| Dampfdruck |
0.0784mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|