ChemNet > CAS > 1638-86-4 Diethyl phenylphosphonite
1638-86-4 Diethyl phenylphosphonite
| produktnavn |
Diethyl phenylphosphonite |
| Engelsk navn |
Diethyl phenylphosphonite; Diethoxyphenylphosphine; Phenylphosphonous acid diethyl ester |
| Molekyl?r Formel |
C10H15O2P |
| Molekylvekt |
198.1987 |
| InChI |
InChI=1/C10H15O2P/c1-3-11-13(12-4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| CAS-nummer |
1638-86-4 |
| EINECS |
216-676-7 |
| Molecular Structure |
|
| Kokepunkt |
235°C at 760 mmHg |
| Flammepunktet |
113°C |
| Damptrykk |
0.0784mmHg at 25°C |
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|