ChemNet > CAS > 1638-86-4 Diethyl phenylphosphonite
1638-86-4 Diethyl phenylphosphonite
| Nome do produto |
Diethyl phenylphosphonite |
| Nome em inglês |
Diethyl phenylphosphonite; Diethoxyphenylphosphine; Phenylphosphonous acid diethyl ester |
| Fórmula molecular |
C10H15O2P |
| Peso Molecular |
198.1987 |
| InChI |
InChI=1/C10H15O2P/c1-3-11-13(12-4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| CAS Registry Number |
1638-86-4 |
| EINECS |
216-676-7 |
| Estrutura Molecular |
|
| Ponto de ebuli??o |
235°C at 760 mmHg |
| O ponto de inflama??o |
113°C |
| Press?o de vapor |
0.0784mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|