959-22-8 4-Nitrophenyl benzoate
| ürün Ad? |
4-Nitrophenyl benzoate |
| ingilizce ad? |
4-Nitrophenyl benzoate; Benzoic acid 4-nitrophenyl ester |
| Moleküler Formülü |
C13H9NO4 |
| Molekül A??rl??? |
243.2149 |
| InChI |
InChI=1/C13H9NO4/c15-13(10-4-2-1-3-5-10)18-12-8-6-11(7-9-12)14(16)17/h1-9H |
| CAS kay?t numaras? |
959-22-8 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.316g/cm3 |
| Kaynama noktas? |
399.5°C at 760 mmHg |
| K?r?lma indisi |
1.614 |
| Alevlenme noktas? |
183.5°C |
| Buhar bas?nc? |
1.37E-06mmHg at 25°C |
| Güvenlik A??klamas? |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|