959-22-8 4-Nitrophenyl benzoate
| Nome do produto |
4-Nitrophenyl benzoate |
| Nome em inglês |
4-Nitrophenyl benzoate; Benzoic acid 4-nitrophenyl ester |
| Fórmula molecular |
C13H9NO4 |
| Peso Molecular |
243.2149 |
| InChI |
InChI=1/C13H9NO4/c15-13(10-4-2-1-3-5-10)18-12-8-6-11(7-9-12)14(16)17/h1-9H |
| CAS Registry Number |
959-22-8 |
| Estrutura Molecular |
|
| Densidade |
1.316g/cm3 |
| Ponto de ebuli??o |
399.5°C at 760 mmHg |
| índice de refra??o |
1.614 |
| O ponto de inflama??o |
183.5°C |
| Press?o de vapor |
1.37E-06mmHg at 25°C |
| Descri??o da Seguran?a |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|