959-22-8 4-Nitrophenyl benzoate
| Nom |
4-Nitrophenyl benzoate |
| Nom anglais |
4-Nitrophenyl benzoate; Benzoic acid 4-nitrophenyl ester |
| Formule moléculaire |
C13H9NO4 |
| Poids Moléculaire |
243.2149 |
| InChI |
InChI=1/C13H9NO4/c15-13(10-4-2-1-3-5-10)18-12-8-6-11(7-9-12)14(16)17/h1-9H |
| Numéro de registre CAS |
959-22-8 |
| Structure moléculaire |
|
| Densité |
1.316g/cm3 |
| Point d'ébullition |
399.5°C at 760 mmHg |
| Indice de réfraction |
1.614 |
| Point d'éclair |
183.5°C |
| Pression de vapeur |
1.37E-06mmHg at 25°C |
| Description de sécurité |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|