959-22-8 4-Nitrophenyl benzoate
| Produkt-Name |
4-Nitrophenyl benzoate |
| Englischer Name |
4-Nitrophenyl benzoate; Benzoic acid 4-nitrophenyl ester |
| Molekulare Formel |
C13H9NO4 |
| Molecular Weight |
243.2149 |
| InChI |
InChI=1/C13H9NO4/c15-13(10-4-2-1-3-5-10)18-12-8-6-11(7-9-12)14(16)17/h1-9H |
| CAS Registry Number |
959-22-8 |
| Molecular Structure |
|
| Dichte |
1.316g/cm3 |
| Siedepunkt |
399.5°C at 760 mmHg |
| Brechungsindex |
1.614 |
| Flammpunkt |
183.5°C |
| Dampfdruck |
1.37E-06mmHg at 25°C |
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|