959-22-8 4-Nitrophenyl benzoate
| produktnavn |
4-Nitrophenyl benzoate |
| Engelsk navn |
4-Nitrophenyl benzoate; Benzoic acid 4-nitrophenyl ester |
| Molekyl?r Formel |
C13H9NO4 |
| Molekylvekt |
243.2149 |
| InChI |
InChI=1/C13H9NO4/c15-13(10-4-2-1-3-5-10)18-12-8-6-11(7-9-12)14(16)17/h1-9H |
| CAS-nummer |
959-22-8 |
| Molecular Structure |
|
| Tetthet |
1.316g/cm3 |
| Kokepunkt |
399.5°C at 760 mmHg |
| Brytningsindeks |
1.614 |
| Flammepunktet |
183.5°C |
| Damptrykk |
1.37E-06mmHg at 25°C |
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|