5445-22-7 Methyl 2-bromooctanoate
| ürün Ad? |
Methyl 2-bromooctanoate |
| ingilizce ad? |
Methyl 2-bromooctanoate; 2-Bromooctanoic acid methyl ester; 2-bromo-octanoicacimethylester; Methyl2-bromooctanoate,99+% |
| Moleküler Formülü |
C9H17BrO2 |
| Molekül A??rl??? |
237.1341 |
| InChI |
InChI=1/C9H17BrO2/c1-3-4-5-6-7-8(10)9(11)12-2/h8H,3-7H2,1-2H3 |
| CAS kay?t numaras? |
5445-22-7 |
| EINECS |
226-644-4 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.221g/cm3 |
| Kaynama noktas? |
227.7°C at 760 mmHg |
| K?r?lma indisi |
1.46 |
| Alevlenme noktas? |
101.9°C |
| Buhar bas?nc? |
0.0763mmHg at 25°C |
| Risk Kodlar? |
R36/38:Irritating to eyes and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|