5445-22-7 Methyl 2-bromooctanoate
| Nome del prodotto |
Methyl 2-bromooctanoate |
| Nome inglese |
Methyl 2-bromooctanoate; 2-Bromooctanoic acid methyl ester; 2-bromo-octanoicacimethylester; Methyl2-bromooctanoate,99+% |
| Formula molecolare |
C9H17BrO2 |
| Peso Molecolare |
237.1341 |
| InChI |
InChI=1/C9H17BrO2/c1-3-4-5-6-7-8(10)9(11)12-2/h8H,3-7H2,1-2H3 |
| Numero CAS |
5445-22-7 |
| EINECS |
226-644-4 |
| Struttura molecolare |
|
| Densità |
1.221g/cm3 |
| Punto di ebollizione |
227.7°C at 760 mmHg |
| Indice di rifrazione |
1.46 |
| Punto d'infiammabilità |
101.9°C |
| Pressione di vapore |
0.0763mmHg at 25°C |
| Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|