5445-22-7 Methyl 2-bromooctanoate
| ??? ?????? |
Methyl 2-bromooctanoate |
| ????? ??????????? |
Methyl 2-bromooctanoate; 2-Bromooctanoic acid methyl ester; 2-bromo-octanoicacimethylester; Methyl2-bromooctanoate,99+% |
| ?????? ???????? |
C9H17BrO2 |
| ????? ??????? ??????? |
237.1341 |
| InChI |
InChI=1/C9H17BrO2/c1-3-4-5-6-7-8(10)9(11)12-2/h8H,3-7H2,1-2H3 |
| ?????????? ???????? ??????? |
5445-22-7 |
| ???????? ????????? ??? |
226-644-4 |
| ???? ?????? |
|
| ????? |
1.221g/cm3 |
| ???? ??????? |
227.7°C at 760 mmHg |
| ????? ???????? |
1.46 |
| ???? ?????? |
101.9°C |
| ??? ?????? |
0.0763mmHg at 25°C |
| ??? ????????? |
R36/38:Irritating to eyes and skin.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|