5445-22-7 Methyl 2-bromooctanoate
| Nome do produto |
Methyl 2-bromooctanoate |
| Nome em inglês |
Methyl 2-bromooctanoate; 2-Bromooctanoic acid methyl ester; 2-bromo-octanoicacimethylester; Methyl2-bromooctanoate,99+% |
| Fórmula molecular |
C9H17BrO2 |
| Peso Molecular |
237.1341 |
| InChI |
InChI=1/C9H17BrO2/c1-3-4-5-6-7-8(10)9(11)12-2/h8H,3-7H2,1-2H3 |
| CAS Registry Number |
5445-22-7 |
| EINECS |
226-644-4 |
| Estrutura Molecular |
|
| Densidade |
1.221g/cm3 |
| Ponto de ebuli??o |
227.7°C at 760 mmHg |
| índice de refra??o |
1.46 |
| O ponto de inflama??o |
101.9°C |
| Press?o de vapor |
0.0763mmHg at 25°C |
| Códigos de risco |
R36/38:Irritating to eyes and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|