5445-22-7 Methyl 2-bromooctanoate
| ?? ????? |
Methyl 2-bromooctanoate |
| ?? ????? |
Methyl 2-bromooctanoate; 2-Bromooctanoic acid methyl ester; 2-bromo-octanoicacimethylester; Methyl2-bromooctanoate,99+% |
| ????????? ??????? |
C9H17BrO2 |
| ???? ???????? |
237.1341 |
| InChI |
InChI=1/C9H17BrO2/c1-3-4-5-6-7-8(10)9(11)12-2/h8H,3-7H2,1-2H3 |
| ???? CAS |
5445-22-7 |
| EINECS |
226-644-4 |
| ???? ???????? |
|
| ?????? |
1.221g/cm3 |
| ????? ????? |
227.7°C at 760 mmHg |
| ???? ????? |
1.46 |
| ????? ???? |
101.9°C |
| ??? ???? |
0.0763mmHg at 25°C |
| ??????? ???? |
R36/38:Irritating to eyes and skin.;
|
| ?????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|