2628-17-3 4-Vinylphenol
| ürün Ad? |
4-Vinylphenol |
| ingilizce ad? |
4-Vinylphenol; 4-Hydroxystyrene; p-Vinylphenol; 4'-Hydroxystyrene |
| Moleküler Formülü |
C8H8O |
| Molekül A??rl??? |
120.15 |
| InChI |
InChI=1/C8H8O/c1-2-7-3-5-8(9)6-4-7/h2-6,9H,1H2 |
| CAS kay?t numaras? |
2628-17-3 |
| EINECS |
220-103-6 |
| Moleküler Yap?s? |
|
| Ergime noktas? |
73℃ |
| Risk Kodlar? |
R36/38:Irritating to eyes and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|