2628-17-3 4-Vinylphenol
| Nama produk |
4-Vinylphenol |
| Nama bahasa Inggris |
4-Vinylphenol; 4-Hydroxystyrene; p-Vinylphenol; 4'-Hydroxystyrene |
| MF |
C8H8O |
| Berat Molekul |
120.15 |
| InChI |
InChI=1/C8H8O/c1-2-7-3-5-8(9)6-4-7/h2-6,9H,1H2 |
| CAS NO |
2628-17-3 |
| EINECS |
220-103-6 |
| Struktur Molekul |
|
| Titik lebur |
73℃ |
| Kode Risiko |
R36/38:Irritating to eyes and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|