2628-17-3 4-Vinylphenol
| Nome do produto |
4-Vinylphenol |
| Nome em inglês |
4-Vinylphenol; 4-Hydroxystyrene; p-Vinylphenol; 4'-Hydroxystyrene |
| Fórmula molecular |
C8H8O |
| Peso Molecular |
120.15 |
| InChI |
InChI=1/C8H8O/c1-2-7-3-5-8(9)6-4-7/h2-6,9H,1H2 |
| CAS Registry Number |
2628-17-3 |
| EINECS |
220-103-6 |
| Estrutura Molecular |
|
| Ponto de fus?o |
73℃ |
| Códigos de risco |
R36/38:Irritating to eyes and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|