2628-17-3 4-Vinylphenol
| Produkt-Name |
4-Vinylphenol |
| Englischer Name |
4-Vinylphenol; 4-Hydroxystyrene; p-Vinylphenol; 4'-Hydroxystyrene |
| Molekulare Formel |
C8H8O |
| Molecular Weight |
120.15 |
| InChI |
InChI=1/C8H8O/c1-2-7-3-5-8(9)6-4-7/h2-6,9H,1H2 |
| CAS Registry Number |
2628-17-3 |
| EINECS |
220-103-6 |
| Molecular Structure |
|
| Schmelzpunkt |
73℃ |
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|