2534-77-2 exo-2-Bromonorbornane
| ürün Ad? |
exo-2-Bromonorbornane |
| ingilizce ad? |
exo-2-Bromonorbornane; exo-2-Bromobicyclo[2.2.1]heptane; 2-bromobicyclo[2.2.1]heptane; (2S)-2-bromobicyclo[2.2.1]heptane; (1S,2S,4R)-2-bromobicyclo[2.2.1]heptane |
| Moleküler Formülü |
C7H11Br |
| Molekül A??rl??? |
175.0662 |
| InChI |
InChI=1/C7H11Br/c8-7-4-5-1-2-6(7)3-5/h5-7H,1-4H2/t5-,6+,7+/m1/s1 |
| CAS kay?t numaras? |
2534-77-2 |
| EINECS |
219-798-9 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.464g/cm3 |
| Kaynama noktas? |
183.8°C at 760 mmHg |
| K?r?lma indisi |
1.55 |
| Alevlenme noktas? |
60°C |
| Buhar bas?nc? |
1.04mmHg at 25°C |
| Tehlike Sembolleri |
Xi:Irritant;
|
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|