2534-77-2 exo-2-Bromonorbornane
| Naam product |
exo-2-Bromonorbornane |
| Engelse naam |
exo-2-Bromonorbornane; exo-2-Bromobicyclo[2.2.1]heptane; 2-bromobicyclo[2.2.1]heptane; (2S)-2-bromobicyclo[2.2.1]heptane; (1S,2S,4R)-2-bromobicyclo[2.2.1]heptane |
| MF |
C7H11Br |
| Molecuulgewicht |
175.0662 |
| InChI |
InChI=1/C7H11Br/c8-7-4-5-1-2-6(7)3-5/h5-7H,1-4H2/t5-,6+,7+/m1/s1 |
| CAS-nummer |
2534-77-2 |
| EINECS |
219-798-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.464g/cm3 |
| Kookpunt |
183.8°C at 760 mmHg |
| Brekingsindex |
1.55 |
| Vlampunt |
60°C |
| Dampdruk |
1.04mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|