2534-77-2 exo-2-Bromonorbornane
| product Name |
exo-2-Bromonorbornane |
| CAS No |
2534-77-2 |
| Synonyms |
exo-2-Bromobicyclo[2.2.1]heptane; 2-bromobicyclo[2.2.1]heptane; (2S)-2-bromobicyclo[2.2.1]heptane; (1S,2S,4R)-2-bromobicyclo[2.2.1]heptane |
| Molecular Formula |
C7H11Br |
| Molecular Weight |
175.0662 |
| InChI |
InChI=1/C7H11Br/c8-7-4-5-1-2-6(7)3-5/h5-7H,1-4H2/t5-,6+,7+/m1/s1 |
| EINECS |
219-798-9 |
| Molecular Structure |
|
| Density |
1.464g/cm3 |
| Boiling point |
183.8°C at 760 mmHg |
| Refractive index |
1.55 |
| Flash point |
60°C |
| Vapour Pressur |
1.04mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Mr Zhang |
| Telephone |
+86-21-58956006 |
| Email |
info@abotto.com |
| Address |
Room 303 Building 5 Hengyue Life Square Lane 1111 Miaojing Road Pudong China |