2534-77-2 exo-2-Bromonorbornane
| termék neve |
exo-2-Bromonorbornane |
| Angol név |
exo-2-Bromonorbornane; exo-2-Bromobicyclo[2.2.1]heptane; 2-bromobicyclo[2.2.1]heptane; (2S)-2-bromobicyclo[2.2.1]heptane; (1S,2S,4R)-2-bromobicyclo[2.2.1]heptane |
| MF |
C7H11Br |
| Molekulat?meg |
175.0662 |
| InChI |
InChI=1/C7H11Br/c8-7-4-5-1-2-6(7)3-5/h5-7H,1-4H2/t5-,6+,7+/m1/s1 |
| CAS-szám |
2534-77-2 |
| EINECS |
219-798-9 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.464g/cm3 |
| Forráspont |
183.8°C at 760 mmHg |
| T?résmutató |
1.55 |
| Gyulladáspont |
60°C |
| G?znyomás |
1.04mmHg at 25°C |
| Veszély szimbólumok |
Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|