2210-28-8 n-Propyl methacrylate
| ürün Ad? |
n-Propyl methacrylate |
| ingilizce ad? |
n-Propyl methacrylate; n-Propyl methacrylate, (Methacrylic acid n-propyl ester); Methacrylic acid n-propyl ester; propyl 2-methylprop-2-enoate |
| Moleküler Formülü |
C7H12O2 |
| Molekül A??rl??? |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-4-5-9-7(8)6(2)3/h2,4-5H2,1,3H3 |
| CAS kay?t numaras? |
2210-28-8 |
| EINECS |
218-639-0 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.899g/cm3 |
| Kaynama noktas? |
141°C at 760 mmHg |
| K?r?lma indisi |
1.416 |
| Alevlenme noktas? |
34.7°C |
| Buhar bas?nc? |
5.98mmHg at 25°C |
| Risk Kodlar? |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|