2210-28-8 n-Propyl methacrylate
| Nome do produto |
n-Propyl methacrylate |
| Nome em inglês |
n-Propyl methacrylate; n-Propyl methacrylate, (Methacrylic acid n-propyl ester); Methacrylic acid n-propyl ester; propyl 2-methylprop-2-enoate |
| Fórmula molecular |
C7H12O2 |
| Peso Molecular |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-4-5-9-7(8)6(2)3/h2,4-5H2,1,3H3 |
| CAS Registry Number |
2210-28-8 |
| EINECS |
218-639-0 |
| Estrutura Molecular |
|
| Densidade |
0.899g/cm3 |
| Ponto de ebuli??o |
141°C at 760 mmHg |
| índice de refra??o |
1.416 |
| O ponto de inflama??o |
34.7°C |
| Press?o de vapor |
5.98mmHg at 25°C |
| Códigos de risco |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|