2210-28-8 n-Propyl methacrylate
| Ονομασ?α του προ??ντο? |
n-Propyl methacrylate |
| Αγγλικ? ?νομα |
n-Propyl methacrylate; n-Propyl methacrylate, (Methacrylic acid n-propyl ester); Methacrylic acid n-propyl ester; propyl 2-methylprop-2-enoate |
| MF |
C7H12O2 |
| Μοριακ? β?ρο? |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-4-5-9-7(8)6(2)3/h2,4-5H2,1,3H3 |
| CAS ΟΧΙ |
2210-28-8 |
| EINECS |
218-639-0 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
0.899g/cm3 |
| Σημε?ο βρασμο? |
141°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.416 |
| Σημε?ο αν?φλεξη? |
34.7°C |
| Π?εση ατμ?ν |
5.98mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|