2210-28-8 n-Propyl methacrylate
| produktnavn |
n-Propyl methacrylate |
| Engelsk navn |
n-Propyl methacrylate; n-Propyl methacrylate, (Methacrylic acid n-propyl ester); Methacrylic acid n-propyl ester; propyl 2-methylprop-2-enoate |
| Molekyl?r Formel |
C7H12O2 |
| Molekylvekt |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-4-5-9-7(8)6(2)3/h2,4-5H2,1,3H3 |
| CAS-nummer |
2210-28-8 |
| EINECS |
218-639-0 |
| Molecular Structure |
|
| Tetthet |
0.899g/cm3 |
| Kokepunkt |
141°C at 760 mmHg |
| Brytningsindeks |
1.416 |
| Flammepunktet |
34.7°C |
| Damptrykk |
5.98mmHg at 25°C |
| Risiko Koder |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|