20426-12-4 4-Hydroxychalcone
| ürün Ad? |
4-Hydroxychalcone |
| ingilizce ad? |
4-Hydroxychalcone; 4-Hydroxybenzylideneacetophenone; 3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one; (2E)-3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one |
| Moleküler Formülü |
C15H12O2 |
| Molekül A??rl??? |
224.2546 |
| InChI |
InChI=1/C15H12O2/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13/h1-11,16H/b11-8+ |
| CAS kay?t numaras? |
20426-12-4 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.191g/cm3 |
| Ergime noktas? |
183-185℃ |
| Kaynama noktas? |
394.9°C at 760 mmHg |
| K?r?lma indisi |
1.653 |
| Alevlenme noktas? |
168.6°C |
| Buhar bas?nc? |
8.41E-07mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|