20426-12-4 4-Hydroxychalcone
| Naam product |
4-Hydroxychalcone |
| Engelse naam |
4-Hydroxychalcone; 4-Hydroxybenzylideneacetophenone; 3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one; (2E)-3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one |
| MF |
C15H12O2 |
| Molecuulgewicht |
224.2546 |
| InChI |
InChI=1/C15H12O2/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13/h1-11,16H/b11-8+ |
| CAS-nummer |
20426-12-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.191g/cm3 |
| Smeltpunt |
183-185℃ |
| Kookpunt |
394.9°C at 760 mmHg |
| Brekingsindex |
1.653 |
| Vlampunt |
168.6°C |
| Dampdruk |
8.41E-07mmHg at 25°C |
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|