20426-12-4 4-Hydroxychalcone
| product Name |
4-Hydroxychalcone |
| CAS No |
20426-12-4 |
| Synonyms |
4-Hydroxybenzylideneacetophenone; 3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one; (2E)-3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one |
| Molecular Formula |
C15H12O2 |
| Molecular Weight |
224.2546 |
| InChI |
InChI=1/C15H12O2/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13/h1-11,16H/b11-8+ |
| Molecular Structure |
|
| Density |
1.191g/cm3 |
| Melting point |
183-185℃ |
| Boiling point |
394.9°C at 760 mmHg |
| Refractive index |
1.653 |
| Flash point |
168.6°C |
| Vapour Pressur |
8.41E-07mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|