20426-12-4 4-Hydroxychalcone
| Produkt-Name |
4-Hydroxychalcone |
| Englischer Name |
4-Hydroxychalcone; 4-Hydroxybenzylideneacetophenone; 3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one; (2E)-3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one |
| Molekulare Formel |
C15H12O2 |
| Molecular Weight |
224.2546 |
| InChI |
InChI=1/C15H12O2/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13/h1-11,16H/b11-8+ |
| CAS Registry Number |
20426-12-4 |
| Molecular Structure |
|
| Dichte |
1.191g/cm3 |
| Schmelzpunkt |
183-185℃ |
| Siedepunkt |
394.9°C at 760 mmHg |
| Brechungsindex |
1.653 |
| Flammpunkt |
168.6°C |
| Dampfdruck |
8.41E-07mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|