1766-76-3 decafluorobenzhydrol
| ürün Ad? |
decafluorobenzhydrol |
| ingilizce ad? |
decafluorobenzhydrol; Bis(pentafluorophenyl) carbinol; Bis(pentafluorophenyl)methanol; bis(pentafluorophenyl)methanol |
| Moleküler Formülü |
C13H2F10O |
| Molekül A??rl??? |
364.1384 |
| InChI |
InChI=1/C13H2F10O/c14-3-1(4(15)8(19)11(22)7(3)18)13(24)2-5(16)9(20)12(23)10(21)6(2)17/h13,24H |
| CAS kay?t numaras? |
1766-76-3 |
| EINECS |
217-185-0 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.74g/cm3 |
| Ergime noktas? |
76-80℃ |
| Kaynama noktas? |
265.2°C at 760 mmHg |
| K?r?lma indisi |
1.457 |
| Alevlenme noktas? |
114.2°C |
| Buhar bas?nc? |
0.00464mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|