1766-76-3 decafluorobenzhydrol
| Nazwa produktu: |
decafluorobenzhydrol |
| Angielska nazwa |
decafluorobenzhydrol; Bis(pentafluorophenyl) carbinol; Bis(pentafluorophenyl)methanol; bis(pentafluorophenyl)methanol |
| MF |
C13H2F10O |
| Masie cz?steczkowej |
364.1384 |
| InChI |
InChI=1/C13H2F10O/c14-3-1(4(15)8(19)11(22)7(3)18)13(24)2-5(16)9(20)12(23)10(21)6(2)17/h13,24H |
| Nr CAS |
1766-76-3 |
| EINECS |
217-185-0 |
| Struktury molekularnej |
|
| G?sto?? |
1.74g/cm3 |
| Temperatura topnienia |
76-80℃ |
| Temperatura wrzenia |
265.2°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.457 |
| Temperatura zap?onu |
114.2°C |
| Ci?nienie pary |
0.00464mmHg at 25°C |
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|