1766-76-3 decafluorobenzhydrol
| Nom |
decafluorobenzhydrol |
| Nom anglais |
decafluorobenzhydrol; Bis(pentafluorophenyl) carbinol; Bis(pentafluorophenyl)methanol; bis(pentafluorophenyl)methanol |
| Formule moléculaire |
C13H2F10O |
| Poids Moléculaire |
364.1384 |
| InChI |
InChI=1/C13H2F10O/c14-3-1(4(15)8(19)11(22)7(3)18)13(24)2-5(16)9(20)12(23)10(21)6(2)17/h13,24H |
| Numéro de registre CAS |
1766-76-3 |
| EINECS |
217-185-0 |
| Structure moléculaire |
|
| Densité |
1.74g/cm3 |
| Point de fusion |
76-80℃ |
| Point d'ébullition |
265.2°C at 760 mmHg |
| Indice de réfraction |
1.457 |
| Point d'éclair |
114.2°C |
| Pression de vapeur |
0.00464mmHg at 25°C |
| Description de sécurité |
S24/25:Avoid contact with skin and eyes.;
|
|