1766-76-3 decafluorobenzhydrol
| product Name |
decafluorobenzhydrol |
| CAS No |
1766-76-3 |
| Synonyms |
Bis(pentafluorophenyl) carbinol; Bis(pentafluorophenyl)methanol; bis(pentafluorophenyl)methanol |
| Molecular Formula |
C13H2F10O |
| Molecular Weight |
364.1384 |
| InChI |
InChI=1/C13H2F10O/c14-3-1(4(15)8(19)11(22)7(3)18)13(24)2-5(16)9(20)12(23)10(21)6(2)17/h13,24H |
| EINECS |
217-185-0 |
| Molecular Structure |
|
| Density |
1.74g/cm3 |
| Melting point |
76-80℃ |
| Boiling point |
265.2°C at 760 mmHg |
| Refractive index |
1.457 |
| Flash point |
114.2°C |
| Vapour Pressur |
0.00464mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|